C41H50ClN3O3 — CID 11679150
13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 11679150) has the molecular formula C41H50ClN3O3 and a molecular weight of 668.32 g/mol. Its IUPAC name is 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11679150 |
| Molecular Formula | C41H50ClN3O3 |
| Molecular Weight | 668.32 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1.Clc1ccc2c(c1)CCc1cccnc1C2=C1CCNCC1 |
| InChI | InChI=1S/C22H31NO3.C19H19ClN2/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20;20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3;1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
| InChIKey | GDZSBRQFEXRJMZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.32 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|