C31H38Cl3NO10Si — CID 11679278
[3,4-diacetyloxy-6-[tert-butyl(diphenyl)silyl]oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 11679278) has the molecular formula C31H38Cl3NO10Si and a molecular weight of 719.09 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[tert-butyl(diphenyl)silyl]oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[tert-butyl(diphenyl)silyl]oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11679278 |
| Molecular Formula | C31H38Cl3NO10Si |
| Molecular Weight | 719.09 g/mol |
| Exact Mass | 717.13 |
| IUPAC Name | [3,4-diacetyloxy-6-[tert-butyl(diphenyl)silyl]oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(NC(=O)OCC(Cl)(Cl)Cl)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C31H38Cl3NO10Si/c1-19(36)40-17-24-26(42-20(2)37)27(43-21(3)38)25(35-29(39)41-18-31(32,33)34)28(44-24)45-46(30(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,24-28H,17-18H2,1-6H3,(H,35,39) |
| InChIKey | UVTNUAUJVSLOTK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.09 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|