C36H54I2N2O4 — CID 11679470
1,10-bis(1-octylpyridin-1-ium-4-yl)decane-2,3,8,9-tetrone diiodide (PubChem CID 11679470) has the molecular formula C36H54I2N2O4 and a molecular weight of 832.65 g/mol. Its IUPAC name is 1,10-bis(1-octylpyridin-1-ium-4-yl)decane-2,3,8,9-tetrone diiodide.
| Compound Name | 1,10-bis(1-octylpyridin-1-ium-4-yl)decane-2,3,8,9-tetrone diiodide |
|---|---|
| PubChem CID | 11679470 |
| Molecular Formula | C36H54I2N2O4 |
| Molecular Weight | 832.65 g/mol |
| Exact Mass | 832.22 |
| IUPAC Name | 1,10-bis(1-octylpyridin-1-ium-4-yl)decane-2,3,8,9-tetrone diiodide |
| SMILES | CCCCCCCC[n+]1ccc(CC(=O)C(=O)CCCCC(=O)C(=O)Cc2cc[n+](CCCCCCCC)cc2)cc1.[I-].[I-] |
| InChI | InChI=1S/C36H54N2O4.2HI/c1-3-5-7-9-11-15-23-37-25-19-31(20-26-37)29-35(41)33(39)17-13-14-18-34(40)36(42)30-32-21-27-38(28-22-32)24-16-12-10-8-6-4-2;;/h19-22,25-28H,3-18,23-24,29-30H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | XELFRYWZTIWERX-UHFFFAOYSA-L |
| XLogP | 0.61 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.65 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|