About 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine
2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine (PubChem CID 116796891) has the molecular formula C10H12N6
and a molecular weight of 216.25 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine |
| PubChem CID | 116796891 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(N2CCn3ccnc3C2)n1 |
| InChI | InChI=1S/C10H12N6/c11-8-1-2-13-10(14-8)16-6-5-15-4-3-12-9(15)7-16/h1-4H,5-7H2,(H2,11,13,14) |
| InChIKey | GOMKMYGEZCUXFI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine?
The IUPAC name of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine (CID 116796891) is 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine.
What is the SMILES notation for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine?
The canonical SMILES for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine is Nc1ccnc(N2CCn3ccnc3C2)n1.
What is the InChIKey of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine?
The InChIKey is GOMKMYGEZCUXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6/c11-8-1-2-13-10(14-8)16-6-5-15-4-3-12-9(15)7-16/h1-4H,5-7H2,(H2,11,13,14).
What are the key properties of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine?
2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine has a molecular weight of 216.25 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)pyrimidin-4-amine is sourced from PubChem (CID 116796891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).