About 2-ethynyl-2-hept-6-enyl-1,3-dioxolane
2-ethynyl-2-hept-6-enyl-1,3-dioxolane (PubChem CID 11679982) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-ethynyl-2-hept-6-enyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-ethynyl-2-hept-6-enyl-1,3-dioxolane |
| PubChem CID | 11679982 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-ethynyl-2-hept-6-enyl-1,3-dioxolane |
| SMILES | C#CC1(CCCCCC=C)OCCO1 |
| InChI | InChI=1S/C12H18O2/c1-3-5-6-7-8-9-12(4-2)13-10-11-14-12/h2-3H,1,5-11H2 |
| InChIKey | RVXGKRUBTSIUAO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-2-hept-6-enyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-2-hept-6-enyl-1,3-dioxolane?
The IUPAC name of 2-ethynyl-2-hept-6-enyl-1,3-dioxolane (CID 11679982) is 2-ethynyl-2-hept-6-enyl-1,3-dioxolane.
What is the SMILES notation for 2-ethynyl-2-hept-6-enyl-1,3-dioxolane?
The canonical SMILES for 2-ethynyl-2-hept-6-enyl-1,3-dioxolane is C#CC1(CCCCCC=C)OCCO1.
What is the InChIKey of 2-ethynyl-2-hept-6-enyl-1,3-dioxolane?
The InChIKey is RVXGKRUBTSIUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-5-6-7-8-9-12(4-2)13-10-11-14-12/h2-3H,1,5-11H2.
What are the key properties of 2-ethynyl-2-hept-6-enyl-1,3-dioxolane?
2-ethynyl-2-hept-6-enyl-1,3-dioxolane has a molecular weight of 194.27 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-2-hept-6-enyl-1,3-dioxolane is sourced from PubChem (CID 11679982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).