About 8-pyridin-2-yl-7H-purine
8-pyridin-2-yl-7H-purine (PubChem CID 11680001) has the molecular formula C10H7N5
and a molecular weight of 197.20 g/mol. Its IUPAC name is 8-pyridin-2-yl-7H-purine.
Molecular Properties
| Compound Name | 8-pyridin-2-yl-7H-purine |
| PubChem CID | 11680001 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 8-pyridin-2-yl-7H-purine |
| SMILES | c1ccc(-c2nc3ncncc3[nH]2)nc1 |
| InChI | InChI=1S/C10H7N5/c1-2-4-12-7(3-1)10-14-8-5-11-6-13-9(8)15-10/h1-6H,(H,11,13,14,15) |
| InChIKey | IKLBKJSFSNHGKO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-pyridin-2-yl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyridin-2-yl-7H-purine?
The IUPAC name of 8-pyridin-2-yl-7H-purine (CID 11680001) is 8-pyridin-2-yl-7H-purine.
What is the SMILES notation for 8-pyridin-2-yl-7H-purine?
The canonical SMILES for 8-pyridin-2-yl-7H-purine is c1ccc(-c2nc3ncncc3[nH]2)nc1.
What is the InChIKey of 8-pyridin-2-yl-7H-purine?
The InChIKey is IKLBKJSFSNHGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5/c1-2-4-12-7(3-1)10-14-8-5-11-6-13-9(8)15-10/h1-6H,(H,11,13,14,15).
What are the key properties of 8-pyridin-2-yl-7H-purine?
8-pyridin-2-yl-7H-purine has a molecular weight of 197.20 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyridin-2-yl-7H-purine is sourced from PubChem (CID 11680001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).