About 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione
3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione (PubChem CID 11680041) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione |
| PubChem CID | 11680041 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1COC(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C11H11NO3/c13-10-8-15-11(14)12(10)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | UCHBCVUDTONWJW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione?
The IUPAC name of 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione (CID 11680041) is 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione is O=C1COC(=O)N1CCc1ccccc1.
What is the InChIKey of 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione?
The InChIKey is UCHBCVUDTONWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-10-8-15-11(14)12(10)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2.
What are the key properties of 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione?
3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione has a molecular weight of 205.21 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethyl)-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 11680041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).