C11H10N2OS — CID 11680142
3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenol (PubChem CID 11680142) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenol.
| Compound Name | 3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenol |
|---|---|
| PubChem CID | 11680142 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenol |
| SMILES | Oc1cccc(C2=CSC3=NCCN23)c1 |
| InChI | InChI=1S/C11H10N2OS/c14-9-3-1-2-8(6-9)10-7-15-11-12-4-5-13(10)11/h1-3,6-7,14H,4-5H2 |
| InChIKey | OPDZQTXVFCASSY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |