About 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine
2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine (PubChem CID 11680163) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine |
| PubChem CID | 11680163 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine |
| SMILES | CC[C@]1(c2ccccc2)OC[C@H](CCN)O1 |
| InChI | InChI=1S/C13H19NO2/c1-2-13(11-6-4-3-5-7-11)15-10-12(16-13)8-9-14/h3-7,12H,2,8-10,14H2,1H3/t12-,13-/m0/s1 |
| InChIKey | OTBOADKGPXWFHX-STQMWFEESA-N |
| XLogP | 2.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine?
The IUPAC name of 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine (CID 11680163) is 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine.
What is the SMILES notation for 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine?
The canonical SMILES for 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine is CC[C@]1(c2ccccc2)OC[C@H](CCN)O1.
What is the InChIKey of 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine?
The InChIKey is OTBOADKGPXWFHX-STQMWFEESA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-13(11-6-4-3-5-7-11)15-10-12(16-13)8-9-14/h3-7,12H,2,8-10,14H2,1H3/t12-,13-/m0/s1.
What are the key properties of 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine?
2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine has a molecular weight of 221.30 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxolan-4-yl]ethanamine is sourced from PubChem (CID 11680163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).