C16H22FN3O — CID 116802111
N-[[2-(1-ethylpyrazol-4-yl)oxy-5-fluorophenyl]methyl]-2-methylpropan-2-amine (PubChem CID 116802111) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[[2-(1-ethylpyrazol-4-yl)oxy-5-fluorophenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(1-ethylpyrazol-4-yl)oxy-5-fluorophenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 116802111 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[2-(1-ethylpyrazol-4-yl)oxy-5-fluorophenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCn1cc(Oc2ccc(F)cc2CNC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H22FN3O/c1-5-20-11-14(10-19-20)21-15-7-6-13(17)8-12(15)9-18-16(2,3)4/h6-8,10-11,18H,5,9H2,1-4H3 |
| InChIKey | MJEQZXMEYBALSJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |