About ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate
ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate (PubChem CID 11680224) has the molecular formula C10H12ClNO3
and a molecular weight of 229.66 g/mol. Its IUPAC name is ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate |
| PubChem CID | 11680224 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c(=O)c(C)c1Cl |
| InChI | InChI=1S/C10H12ClNO3/c1-4-15-10(14)7-5-12(3)9(13)6(2)8(7)11/h5H,4H2,1-3H3 |
| InChIKey | LRPZMBUONONUPF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate?
The IUPAC name of ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate (CID 11680224) is ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate?
The canonical SMILES for ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate is CCOC(=O)c1cn(C)c(=O)c(C)c1Cl.
What is the InChIKey of ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate?
The InChIKey is LRPZMBUONONUPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO3/c1-4-15-10(14)7-5-12(3)9(13)6(2)8(7)11/h5H,4H2,1-3H3.
What are the key properties of ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate?
ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate has a molecular weight of 229.66 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-1,5-dimethyl-6-oxopyridine-3-carboxylate is sourced from PubChem (CID 11680224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).