C11H16F2N4 — CID 11680314
N-ethyl-5,8-difluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazin-7-amine (PubChem CID 11680314) has the molecular formula C11H16F2N4 and a molecular weight of 242.27 g/mol. Its IUPAC name is N-ethyl-5,8-difluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazin-7-amine.
| Compound Name | N-ethyl-5,8-difluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 11680314 |
| Molecular Formula | C11H16F2N4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-ethyl-5,8-difluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazin-7-amine |
| SMILES | CCNc1nc(F)c2c(c1F)N(C)CCN2C |
| InChI | InChI=1S/C11H16F2N4/c1-4-14-11-7(12)8-9(10(13)15-11)17(3)6-5-16(8)2/h4-6H2,1-3H3,(H,14,15) |
| InChIKey | XBESTZPXLJEABH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|