C16H23N3O2 — CID 116803276
N-[[3-[2-(1-ethylpyrazol-4-yl)oxyethoxy]phenyl]methyl]ethanamine (PubChem CID 116803276) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[[3-[2-(1-ethylpyrazol-4-yl)oxyethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[3-[2-(1-ethylpyrazol-4-yl)oxyethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116803276 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[[3-[2-(1-ethylpyrazol-4-yl)oxyethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(OCCOc2cnn(CC)c2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-3-17-11-14-6-5-7-15(10-14)20-8-9-21-16-12-18-19(4-2)13-16/h5-7,10,12-13,17H,3-4,8-9,11H2,1-2H3 |
| InChIKey | OBUHGKGFUKVHKA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|