C14H15NO3 — CID 11680341
4-(1-hydroxyethyl)-6,7,8,9-tetrahydropyrano[3,2-g]quinolin-2-one (PubChem CID 11680341) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-6,7,8,9-tetrahydropyrano[3,2-g]quinolin-2-one.
| Compound Name | 4-(1-hydroxyethyl)-6,7,8,9-tetrahydropyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 11680341 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-(1-hydroxyethyl)-6,7,8,9-tetrahydropyrano[3,2-g]quinolin-2-one |
| SMILES | CC(O)c1cc(=O)oc2cc3c(cc12)CCCN3 |
| InChI | InChI=1S/C14H15NO3/c1-8(16)10-6-14(17)18-13-7-12-9(5-11(10)13)3-2-4-15-12/h5-8,15-16H,2-4H2,1H3 |
| InChIKey | FRTWDKRQGRIAHC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|