C16H19N3O2 — CID 116803468
[3-[(1-propylpyrazol-4-yl)oxymethyl]-1-benzofuran-2-yl]methanamine (PubChem CID 116803468) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is [3-[(1-propylpyrazol-4-yl)oxymethyl]-1-benzofuran-2-yl]methanamine.
| Compound Name | [3-[(1-propylpyrazol-4-yl)oxymethyl]-1-benzofuran-2-yl]methanamine |
|---|---|
| PubChem CID | 116803468 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [3-[(1-propylpyrazol-4-yl)oxymethyl]-1-benzofuran-2-yl]methanamine |
| SMILES | CCCn1cc(OCc2c(CN)oc3ccccc23)cn1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-7-19-10-12(9-18-19)20-11-14-13-5-3-4-6-15(13)21-16(14)8-17/h3-6,9-10H,2,7-8,11,17H2,1H3 |
| InChIKey | MWQPQWCYDIEAAE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |