C7H7IO2 — CID 11680378
(1R,2R,4S,7R)-5-iodo-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 11680378) has the molecular formula C7H7IO2 and a molecular weight of 250.03 g/mol. Its IUPAC name is (1R,2R,4S,7R)-5-iodo-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene.
| Compound Name | (1R,2R,4S,7R)-5-iodo-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
|---|---|
| PubChem CID | 11680378 |
| Molecular Formula | C7H7IO2 |
| Molecular Weight | 250.03 g/mol |
| Exact Mass | 249.95 |
| IUPAC Name | (1R,2R,4S,7R)-5-iodo-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | C[C@@]12O[C@@H]1C=C(I)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C7H7IO2/c1-7-4(10-7)2-3(8)5-6(7)9-5/h2,4-6H,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | NIQKMAYNWUXDGV-DBRKOABJSA-N |
| XLogP | 1.24 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.03 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|