C9H13ClN2O3 — CID 116804052
2-chloro-3-(1-propan-2-ylpyrazol-4-yl)oxypropanoic acid (PubChem CID 116804052) has the molecular formula C9H13ClN2O3 and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-chloro-3-(1-propan-2-ylpyrazol-4-yl)oxypropanoic acid.
| Compound Name | 2-chloro-3-(1-propan-2-ylpyrazol-4-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 116804052 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-chloro-3-(1-propan-2-ylpyrazol-4-yl)oxypropanoic acid |
| SMILES | CC(C)n1cc(OCC(Cl)C(=O)O)cn1 |
| InChI | InChI=1S/C9H13ClN2O3/c1-6(2)12-4-7(3-11-12)15-5-8(10)9(13)14/h3-4,6,8H,5H2,1-2H3,(H,13,14) |
| InChIKey | BYHMPPCSMLQGKD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|