C14H25NOS — CID 11680430
[(1S,2R,4R)-7,7-dimethyl-2-morpholin-4-yl-1-bicyclo[2.2.1]heptanyl]methanethiol (PubChem CID 11680430) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is [(1S,2R,4R)-7,7-dimethyl-2-morpholin-4-yl-1-bicyclo[2.2.1]heptanyl]methanethiol.
| Compound Name | [(1S,2R,4R)-7,7-dimethyl-2-morpholin-4-yl-1-bicyclo[2.2.1]heptanyl]methanethiol |
|---|---|
| PubChem CID | 11680430 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | [(1S,2R,4R)-7,7-dimethyl-2-morpholin-4-yl-1-bicyclo[2.2.1]heptanyl]methanethiol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS)[C@H](N1CCOCC1)C2 |
| InChI | InChI=1S/C14H25NOS/c1-13(2)11-3-4-14(13,10-17)12(9-11)15-5-7-16-8-6-15/h11-12,17H,3-10H2,1-2H3/t11-,12-,14-/m1/s1 |
| InChIKey | RXWAXIDATPTAOS-YRGRVCCFSA-N |
| XLogP | 2.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|