About 1-ethyl-4-hexoxypyrazole
1-ethyl-4-hexoxypyrazole (PubChem CID 116804751) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-ethyl-4-hexoxypyrazole.
Molecular Properties
| Compound Name | 1-ethyl-4-hexoxypyrazole |
| PubChem CID | 116804751 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-ethyl-4-hexoxypyrazole |
| SMILES | CCCCCCOc1cnn(CC)c1 |
| InChI | InChI=1S/C11H20N2O/c1-3-5-6-7-8-14-11-9-12-13(4-2)10-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | UTDUTQHVCDRHHI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-hexoxypyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-hexoxypyrazole?
The IUPAC name of 1-ethyl-4-hexoxypyrazole (CID 116804751) is 1-ethyl-4-hexoxypyrazole.
What is the SMILES notation for 1-ethyl-4-hexoxypyrazole?
The canonical SMILES for 1-ethyl-4-hexoxypyrazole is CCCCCCOc1cnn(CC)c1.
What is the InChIKey of 1-ethyl-4-hexoxypyrazole?
The InChIKey is UTDUTQHVCDRHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-3-5-6-7-8-14-11-9-12-13(4-2)10-11/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-ethyl-4-hexoxypyrazole?
1-ethyl-4-hexoxypyrazole has a molecular weight of 196.29 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-hexoxypyrazole is sourced from PubChem (CID 116804751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).