C8H11N3O2 — CID 116805998
4-(5-ethenyl-1,2,4-oxadiazol-3-yl)morpholine (PubChem CID 116805998) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(5-ethenyl-1,2,4-oxadiazol-3-yl)morpholine.
| Compound Name | 4-(5-ethenyl-1,2,4-oxadiazol-3-yl)morpholine |
|---|---|
| PubChem CID | 116805998 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-(5-ethenyl-1,2,4-oxadiazol-3-yl)morpholine |
| SMILES | C=Cc1nc(N2CCOCC2)no1 |
| InChI | InChI=1S/C8H11N3O2/c1-2-7-9-8(10-13-7)11-3-5-12-6-4-11/h2H,1,3-6H2 |
| InChIKey | MEPJRXBQDSAAMI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |