About 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide
4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide (PubChem CID 11680603) has the molecular formula C13H10N4OS
and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide |
| PubChem CID | 11680603 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide |
| SMILES | NC(=O)c1nnc(N)c2cc(-c3ccccc3)sc12 |
| InChI | InChI=1S/C13H10N4OS/c14-12-8-6-9(7-4-2-1-3-5-7)19-11(8)10(13(15)18)16-17-12/h1-6H,(H2,14,17)(H2,15,18) |
| InChIKey | AZJVXFCDAPLPLE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide?
The IUPAC name of 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide (CID 11680603) is 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide.
What is the SMILES notation for 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide?
The canonical SMILES for 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide is NC(=O)c1nnc(N)c2cc(-c3ccccc3)sc12.
What is the InChIKey of 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide?
The InChIKey is AZJVXFCDAPLPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4OS/c14-12-8-6-9(7-4-2-1-3-5-7)19-11(8)10(13(15)18)16-17-12/h1-6H,(H2,14,17)(H2,15,18).
What are the key properties of 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide?
4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide has a molecular weight of 270.32 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-phenylthieno[2,3-d]pyridazine-7-carboxamide is sourced from PubChem (CID 11680603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).