C15H20N4O — CID 116806191
N,N-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 116806191) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N,N-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | N,N-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 116806191 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N,N-diethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CCN(CC)c1noc(C2Cc3ccccc3CN2)n1 |
| InChI | InChI=1S/C15H20N4O/c1-3-19(4-2)15-17-14(20-18-15)13-9-11-7-5-6-8-12(11)10-16-13/h5-8,13,16H,3-4,9-10H2,1-2H3 |
| InChIKey | CXEVPAHPDVQXJF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |