C10H18O9 — CID 11680751
(2R,3R,4R)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxypentan-1-one (PubChem CID 11680751) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2R,3R,4R)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxypentan-1-one.
| Compound Name | (2R,3R,4R)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxypentan-1-one |
|---|---|
| PubChem CID | 11680751 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2R,3R,4R)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxypentan-1-one |
| SMILES | O=C(C1O[C@H](CO)[C@@H](O)[C@H]1O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O9/c11-1-3(13)5(14)7(16)9(18)10-8(17)6(15)4(2-12)19-10/h3-8,10-17H,1-2H2/t3-,4-,5-,6-,7-,8-,10?/m1/s1 |
| InChIKey | SXXHVURFCLLLNG-UYFMFYFCSA-N |
| XLogP | -4.89 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |