C13H21N3O2 — CID 116808740
2-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one (PubChem CID 116808740) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one.
| Compound Name | 2-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 116808740 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
| SMILES | CCN(CC)c1noc(C2CCCCCC2=O)n1 |
| InChI | InChI=1S/C13H21N3O2/c1-3-16(4-2)13-14-12(18-15-13)10-8-6-5-7-9-11(10)17/h10H,3-9H2,1-2H3 |
| InChIKey | WMODULATURYQGQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |