C9H13N3O2 — CID 116808785
1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanone (PubChem CID 116808785) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanone.
| Compound Name | 1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116808785 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanone |
| SMILES | CC(=O)c1nc(N2CCCCC2)no1 |
| InChI | InChI=1S/C9H13N3O2/c1-7(13)8-10-9(11-14-8)12-5-3-2-4-6-12/h2-6H2,1H3 |
| InChIKey | WASLGIJUSUKMSD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |