C13H15FO5S — CID 11681015
methyl 4-(4-fluorophenyl)sulfonyloxane-4-carboxylate (PubChem CID 11681015) has the molecular formula C13H15FO5S and a molecular weight of 302.32 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)sulfonyloxane-4-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 11681015 |
| Molecular Formula | C13H15FO5S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methyl 4-(4-fluorophenyl)sulfonyloxane-4-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C13H15FO5S/c1-18-12(15)13(6-8-19-9-7-13)20(16,17)11-4-2-10(14)3-5-11/h2-5H,6-9H2,1H3 |
| InChIKey | APAOKBGRCOUICN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |