C19H30O3 — CID 11681076
(6S,8S,9R)-3,5,9,11-tetramethyl-2,8-di(propan-2-yl)-1,7-dioxaspiro[5.5]undeca-2,10-dien-4-one (PubChem CID 11681076) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (6S,8S,9R)-3,5,9,11-tetramethyl-2,8-di(propan-2-yl)-1,7-dioxaspiro[5.5]undeca-2,10-dien-4-one.
| Compound Name | (6S,8S,9R)-3,5,9,11-tetramethyl-2,8-di(propan-2-yl)-1,7-dioxaspiro[5.5]undeca-2,10-dien-4-one |
|---|---|
| PubChem CID | 11681076 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (6S,8S,9R)-3,5,9,11-tetramethyl-2,8-di(propan-2-yl)-1,7-dioxaspiro[5.5]undeca-2,10-dien-4-one |
| SMILES | CC1=C[C@@H](C)[C@H](C(C)C)O[C@@]12OC(C(C)C)=C(C)C(=O)C2C |
| InChI | InChI=1S/C19H30O3/c1-10(2)17-12(5)9-13(6)19(21-17)15(8)16(20)14(7)18(22-19)11(3)4/h9-12,15,17H,1-8H3/t12-,15?,17+,19-/m1/s1 |
| InChIKey | HTYQVADZVDZFAG-SVNSMWARSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|