C12H15NO3 — CID 116811529
(1-aminocyclopropyl)-(2,6-dimethoxyphenyl)methanone (PubChem CID 116811529) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1-aminocyclopropyl)-(2,6-dimethoxyphenyl)methanone.
| Compound Name | (1-aminocyclopropyl)-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 116811529 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1-aminocyclopropyl)-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)C1(N)CC1 |
| InChI | InChI=1S/C12H15NO3/c1-15-8-4-3-5-9(16-2)10(8)11(14)12(13)6-7-12/h3-5H,6-7,13H2,1-2H3 |
| InChIKey | LKYZPIIKEKGCMW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |