C10H8BrClN2S — CID 116811845
5-(4-bromo-2-chlorophenyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 116811845) has the molecular formula C10H8BrClN2S and a molecular weight of 303.61 g/mol. Its IUPAC name is 5-(4-bromo-2-chlorophenyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(4-bromo-2-chlorophenyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 116811845 |
| Molecular Formula | C10H8BrClN2S |
| Molecular Weight | 303.61 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 5-(4-bromo-2-chlorophenyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1ncc(-c2ccc(Br)cc2Cl)s1 |
| InChI | InChI=1S/C10H8BrClN2S/c1-13-10-14-5-9(15-10)7-3-2-6(11)4-8(7)12/h2-5H,1H3,(H,13,14) |
| InChIKey | ALLAJJGFXZMOJP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |