C15H9ClFN5 — CID 11681189
N-(3-chloro-4-fluorophenyl)-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine (PubChem CID 11681189) has the molecular formula C15H9ClFN5 and a molecular weight of 313.72 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine |
|---|---|
| PubChem CID | 11681189 |
| Molecular Formula | C15H9ClFN5 |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine |
| SMILES | Fc1ccc(Nc2ncnc3nn4ccccc4c23)cc1Cl |
| InChI | InChI=1S/C15H9ClFN5/c16-10-7-9(4-5-11(10)17)20-14-13-12-3-1-2-6-22(12)21-15(13)19-8-18-14/h1-8H,(H,18,19,20,21) |
| InChIKey | KHIJZOQIPUVEBP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |