C17H14O4S — CID 11681277
3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one (PubChem CID 11681277) has the molecular formula C17H14O4S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one.
| Compound Name | 3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 11681277 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one |
| SMILES | [2H]c1c([2H])c([2H])c(C2=C(c3ccc(S(C)(=O)=O)cc3)COC2=O)c([2H])c1[2H] |
| InChI | InChI=1S/C17H14O4S/c1-22(19,20)14-9-7-12(8-10-14)15-11-21-17(18)16(15)13-5-3-2-4-6-13/h2-10H,11H2,1H3/i2D,3D,4D,5D,6D |
| InChIKey | RZJQGNCSTQAWON-VIQYUKPQSA-N |
| XLogP | 2.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|