About N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine
N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine (PubChem CID 116812890) has the molecular formula C13H19FN2
and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine.
Molecular Properties
| Compound Name | N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine |
| PubChem CID | 116812890 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine |
| SMILES | CC1CCCC(C)C1Nc1cccc(F)n1 |
| InChI | InChI=1S/C13H19FN2/c1-9-5-3-6-10(2)13(9)16-12-8-4-7-11(14)15-12/h4,7-10,13H,3,5-6H2,1-2H3,(H,15,16) |
| InChIKey | ASZKBPLBTDCZTQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine?
The IUPAC name of N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine (CID 116812890) is N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine.
What is the SMILES notation for N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine?
The canonical SMILES for N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine is CC1CCCC(C)C1Nc1cccc(F)n1.
What is the InChIKey of N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine?
The InChIKey is ASZKBPLBTDCZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2/c1-9-5-3-6-10(2)13(9)16-12-8-4-7-11(14)15-12/h4,7-10,13H,3,5-6H2,1-2H3,(H,15,16).
What are the key properties of N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine?
N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine has a molecular weight of 222.31 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylcyclohexyl)-6-fluoropyridin-2-amine is sourced from PubChem (CID 116812890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).