C18H15N3O3 — CID 11681316
3-methoxy-4-(5H-triazolo[5,1-a]isoindol-1-ylmethoxy)benzaldehyde (PubChem CID 11681316) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-methoxy-4-(5H-triazolo[5,1-a]isoindol-1-ylmethoxy)benzaldehyde.
| Compound Name | 3-methoxy-4-(5H-triazolo[5,1-a]isoindol-1-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 11681316 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-methoxy-4-(5H-triazolo[5,1-a]isoindol-1-ylmethoxy)benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1nnn2c1-c1ccccc1C2 |
| InChI | InChI=1S/C18H15N3O3/c1-23-17-8-12(10-22)6-7-16(17)24-11-15-18-14-5-3-2-4-13(14)9-21(18)20-19-15/h2-8,10H,9,11H2,1H3 |
| InChIKey | SGNVGVHHQRFAHP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|