C16H23NO4Si — CID 11681324
6-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-4H-1,4-benzoxazin-3-one (PubChem CID 11681324) has the molecular formula C16H23NO4Si and a molecular weight of 321.45 g/mol. Its IUPAC name is 6-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 11681324 |
| Molecular Formula | C16H23NO4Si |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 6-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)c1ccc2c(c1)NC(=O)C(O[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C16H23NO4Si/c1-10(18)11-7-8-13-12(9-11)17-14(19)15(20-13)21-22(5,6)16(2,3)4/h7-9,15H,1-6H3,(H,17,19) |
| InChIKey | OREKIYXVKLZSOA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|