About 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one
2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one (PubChem CID 11681405) has the molecular formula C18H18N2O4
and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one |
| PubChem CID | 11681405 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one |
| SMILES | CCCCc1nc2cc(O)cc(O)c2c(=O)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-2-3-4-16-19-14-9-13(22)10-15(23)17(14)18(24)20(16)11-5-7-12(21)8-6-11/h5-10,21-23H,2-4H2,1H3 |
| InChIKey | NTRGIKZRUCVMNQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The IUPAC name of 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one (CID 11681405) is 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one.
What is the SMILES notation for 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The canonical SMILES for 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one is CCCCc1nc2cc(O)cc(O)c2c(=O)n1-c1ccc(O)cc1.
What is the InChIKey of 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
The InChIKey is NTRGIKZRUCVMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4/c1-2-3-4-16-19-14-9-13(22)10-15(23)17(14)18(24)20(16)11-5-7-12(21)8-6-11/h5-10,21-23H,2-4H2,1H3.
What are the key properties of 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one?
2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one has a molecular weight of 326.35 g/mol, XLogP of 2.85, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5,7-dihydroxy-3-(4-hydroxyphenyl)quinazolin-4-one is sourced from PubChem (CID 11681405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).