C14H25F3O3Si — CID 11681414
ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6,6-trifluorohex-2-enoate (PubChem CID 11681414) has the molecular formula C14H25F3O3Si and a molecular weight of 326.43 g/mol. Its IUPAC name is ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6,6-trifluorohex-2-enoate.
| Compound Name | ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6,6-trifluorohex-2-enoate |
|---|---|
| PubChem CID | 11681414 |
| Molecular Formula | C14H25F3O3Si |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | ethyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6,6-trifluorohex-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H25F3O3Si/c1-7-19-12(18)10-8-9-11(14(15,16)17)20-21(5,6)13(2,3)4/h8,10-11H,7,9H2,1-6H3/b10-8+/t11-/m1/s1 |
| InChIKey | FBBBGBXCRYIDKI-RJCSOLBVSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|