C15H20ClNO2S — CID 116814973
1-(4-chlorobutylsulfonyl)-4-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 116814973) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 1-(4-chlorobutylsulfonyl)-4-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-chlorobutylsulfonyl)-4-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 116814973 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-(4-chlorobutylsulfonyl)-4-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(CCCCCl)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20ClNO2S/c16-10-4-5-13-20(18,19)17-11-8-15(9-12-17)14-6-2-1-3-7-14/h1-3,6-8H,4-5,9-13H2 |
| InChIKey | GXKSLXUWPJQIHB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|