C10H21ClN2O3S — CID 116815240
2-[4-chlorobutylsulfonyl(methyl)amino]-N-propan-2-ylacetamide (PubChem CID 116815240) has the molecular formula C10H21ClN2O3S and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-[4-chlorobutylsulfonyl(methyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-chlorobutylsulfonyl(methyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 116815240 |
| Molecular Formula | C10H21ClN2O3S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[4-chlorobutylsulfonyl(methyl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)S(=O)(=O)CCCCCl |
| InChI | InChI=1S/C10H21ClN2O3S/c1-9(2)12-10(14)8-13(3)17(15,16)7-5-4-6-11/h9H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | HVLSOVMERQYIGT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|