C14H16Cl2N2O2S — CID 116815533
4-chloro-N-(6-chloro-8-methylquinolin-5-yl)butane-1-sulfonamide (PubChem CID 116815533) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is 4-chloro-N-(6-chloro-8-methylquinolin-5-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(6-chloro-8-methylquinolin-5-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815533 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-chloro-N-(6-chloro-8-methylquinolin-5-yl)butane-1-sulfonamide |
| SMILES | Cc1cc(Cl)c(NS(=O)(=O)CCCCCl)c2cccnc12 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c1-10-9-12(16)14(11-5-4-7-17-13(10)11)18-21(19,20)8-3-2-6-15/h4-5,7,9,18H,2-3,6,8H2,1H3 |
| InChIKey | JABUKLZFWPGIBJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|