C14H21ClN2O3S — CID 116815540
3-(4-chlorobutylsulfonylamino)-N-propylbenzamide (PubChem CID 116815540) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 3-(4-chlorobutylsulfonylamino)-N-propylbenzamide.
| Compound Name | 3-(4-chlorobutylsulfonylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 116815540 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-(4-chlorobutylsulfonylamino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(NS(=O)(=O)CCCCCl)c1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-2-9-16-14(18)12-6-5-7-13(11-12)17-21(19,20)10-4-3-8-15/h5-7,11,17H,2-4,8-10H2,1H3,(H,16,18) |
| InChIKey | UFNUTCAGAJFDQG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|