C17H22ClN3S — CID 11681558
3-[1-(5-chlorothiophen-2-yl)cyclopentyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 11681558) has the molecular formula C17H22ClN3S and a molecular weight of 335.90 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophen-2-yl)cyclopentyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-[1-(5-chlorothiophen-2-yl)cyclopentyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 11681558 |
| Molecular Formula | C17H22ClN3S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-[1-(5-chlorothiophen-2-yl)cyclopentyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | Clc1ccc(C2(c3nnc4n3CCCCCC4)CCCC2)s1 |
| InChI | InChI=1S/C17H22ClN3S/c18-14-9-8-13(22-14)17(10-4-5-11-17)16-20-19-15-7-3-1-2-6-12-21(15)16/h8-9H,1-7,10-12H2 |
| InChIKey | ASSZBEZZTSCHQL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |