C14H19ClN2O3S — CID 116815862
4-(4-chlorobutylsulfonylamino)-N-prop-2-enylbenzamide (PubChem CID 116815862) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-(4-chlorobutylsulfonylamino)-N-prop-2-enylbenzamide.
| Compound Name | 4-(4-chlorobutylsulfonylamino)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 116815862 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-(4-chlorobutylsulfonylamino)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NS(=O)(=O)CCCCCl)cc1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-2-10-16-14(18)12-5-7-13(8-6-12)17-21(19,20)11-4-3-9-15/h2,5-8,17H,1,3-4,9-11H2,(H,16,18) |
| InChIKey | MIFSOBZFXFZWBH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|