C10H15ClN2O2S — CID 116816180
4-chloro-N-(4-methyl-3-pyridinyl)butane-1-sulfonamide (PubChem CID 116816180) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 4-chloro-N-(4-methyl-3-pyridinyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(4-methyl-3-pyridinyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116816180 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-chloro-N-(4-methyl-3-pyridinyl)butane-1-sulfonamide |
| SMILES | Cc1ccncc1NS(=O)(=O)CCCCCl |
| InChI | InChI=1S/C10H15ClN2O2S/c1-9-4-6-12-8-10(9)13-16(14,15)7-3-2-5-11/h4,6,8,13H,2-3,5,7H2,1H3 |
| InChIKey | NMELJDOHFXJHEK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|