About 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide
4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide (PubChem CID 116816594) has the molecular formula C7H12ClN3O3S
and a molecular weight of 253.71 g/mol. Its IUPAC name is 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide |
| PubChem CID | 116816594 |
| Molecular Formula | C7H12ClN3O3S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)CCCCCl)o1 |
| InChI | InChI=1S/C7H12ClN3O3S/c1-6-9-10-7(14-6)11-15(12,13)5-3-2-4-8/h2-5H2,1H3,(H,10,11) |
| InChIKey | PBDMWIATGHARTH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide?
The IUPAC name of 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide (CID 116816594) is 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide.
What is the SMILES notation for 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide?
The canonical SMILES for 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide is Cc1nnc(NS(=O)(=O)CCCCCl)o1.
What is the InChIKey of 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide?
The InChIKey is PBDMWIATGHARTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN3O3S/c1-6-9-10-7(14-6)11-15(12,13)5-3-2-4-8/h2-5H2,1H3,(H,10,11).
What are the key properties of 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide?
4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide has a molecular weight of 253.71 g/mol, XLogP of 1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(5-methyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide is sourced from PubChem (CID 116816594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).