C12H16N2O2S2 — CID 116816689
3-[5-[(1,1-dioxothiazinan-2-yl)methyl]thiophen-2-yl]prop-2-yn-1-amine (PubChem CID 116816689) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 3-[5-[(1,1-dioxothiazinan-2-yl)methyl]thiophen-2-yl]prop-2-yn-1-amine.
| Compound Name | 3-[5-[(1,1-dioxothiazinan-2-yl)methyl]thiophen-2-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 116816689 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[5-[(1,1-dioxothiazinan-2-yl)methyl]thiophen-2-yl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(CN2CCCCS2(=O)=O)s1 |
| InChI | InChI=1S/C12H16N2O2S2/c13-7-3-4-11-5-6-12(17-11)10-14-8-1-2-9-18(14,15)16/h5-6H,1-2,7-10,13H2 |
| InChIKey | CORYBAQRTVJEFZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|