About 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol
3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol (PubChem CID 116816741) has the molecular formula C9H19NO3S
and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol |
| PubChem CID | 116816741 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CN1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H19NO3S/c1-9(2,8-11)7-10-5-3-4-6-14(10,12)13/h11H,3-8H2,1-2H3 |
| InChIKey | PMGAURJHRYVBAR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol (CID 116816741) is 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol is CC(C)(CO)CN1CCCCS1(=O)=O.
What is the InChIKey of 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol?
The InChIKey is PMGAURJHRYVBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S/c1-9(2,8-11)7-10-5-3-4-6-14(10,12)13/h11H,3-8H2,1-2H3.
What are the key properties of 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol?
3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol has a molecular weight of 221.32 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiazinan-2-yl)-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 116816741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).