About 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine
1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine (PubChem CID 116816809) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine |
| PubChem CID | 116816809 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine |
| SMILES | NC(CN1CCCCS1(=O)=O)C1CC1 |
| InChI | InChI=1S/C9H18N2O2S/c10-9(8-3-4-8)7-11-5-1-2-6-14(11,12)13/h8-9H,1-7,10H2 |
| InChIKey | JBEXJXCWFOCEJI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine?
The IUPAC name of 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine (CID 116816809) is 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine.
What is the SMILES notation for 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine?
The canonical SMILES for 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine is NC(CN1CCCCS1(=O)=O)C1CC1.
What is the InChIKey of 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine?
The InChIKey is JBEXJXCWFOCEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c10-9(8-3-4-8)7-11-5-1-2-6-14(11,12)13/h8-9H,1-7,10H2.
What are the key properties of 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine?
1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine has a molecular weight of 218.32 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(1,1-dioxothiazinan-2-yl)ethanamine is sourced from PubChem (CID 116816809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).