About 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide
2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide (PubChem CID 116816854) has the molecular formula C12H21NO4S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide |
| PubChem CID | 116816854 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H21NO4S/c14-18(15)10-2-1-7-13(18)11-3-5-12(6-4-11)16-8-9-17-12/h11H,1-10H2 |
| InChIKey | LGOZWPQNADNAMP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide?
The IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide (CID 116816854) is 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide?
The canonical SMILES for 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide is O=S1(=O)CCCCN1C1CCC2(CC1)OCCO2.
What is the InChIKey of 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide?
The InChIKey is LGOZWPQNADNAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4S/c14-18(15)10-2-1-7-13(18)11-3-5-12(6-4-11)16-8-9-17-12/h11H,1-10H2.
What are the key properties of 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide?
2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide has a molecular weight of 275.37 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.5]decan-8-yl)thiazinane 1,1-dioxide is sourced from PubChem (CID 116816854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).