C15H25N3O — CID 116817089
N-(4-cyanocyclohexyl)-N,1-dimethylpiperidine-3-carboxamide (PubChem CID 116817089) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(4-cyanocyclohexyl)-N,1-dimethylpiperidine-3-carboxamide.
| Compound Name | N-(4-cyanocyclohexyl)-N,1-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 116817089 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N-(4-cyanocyclohexyl)-N,1-dimethylpiperidine-3-carboxamide |
| SMILES | CN1CCCC(C(=O)N(C)C2CCC(C#N)CC2)C1 |
| InChI | InChI=1S/C15H25N3O/c1-17-9-3-4-13(11-17)15(19)18(2)14-7-5-12(10-16)6-8-14/h12-14H,3-9,11H2,1-2H3 |
| InChIKey | UNZNLURWWZCTSG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |