C15H15NO — CID 116817431
6-(3-methylphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116817431) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-(3-methylphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-(3-methylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116817431 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 6-(3-methylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1cccc(-c2ccc3c(c2)NCCO3)c1 |
| InChI | InChI=1S/C15H15NO/c1-11-3-2-4-12(9-11)13-5-6-15-14(10-13)16-7-8-17-15/h2-6,9-10,16H,7-8H2,1H3 |
| InChIKey | VQOVVYOJVNSLAQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |